pindolol
| SMILES | OC(COc1cccc2c1cc[nH]2)CNC(C)C |
| InChIKey | JZQKKSLKJUAGIC-UHFFFAOYSA-N |
Chemical properties
| Hydrogen bond acceptors | 3 |
| Hydrogen bond donors | 3 |
| Rotatable bonds | 6 |
| Molecular weight (Da) | 248.2 |
Drug properties
| Molecular type | Small molecule |
| Physiological/Surrogate | Surrogate |
| Approved drug | Yes |
Bioactivities
| Receptor | Activity | Source | |||||||
|---|---|---|---|---|---|---|---|---|---|
| GTP | Uniprot | Species | Family | Class | Type | Min | Avg | Max | Database |
| β3 | ADRB3 | Human | Adrenoceptors | A | pKi | 7.1 | 7.1 | 7.1 | Guide to Pharmacology |
| 5-HT1A | 5HT1A | Human | 5-Hydroxytryptamine | A | pKi | 8.1 | 8.1 | 8.1 | Guide to Pharmacology |
| 5-HT2A | 5HT2A | Human | 5-Hydroxytryptamine | A | pKi | 5.0 | 5.0 | 5.0 | Guide to Pharmacology |
| 5-HT2B | 5HT2B | Human | 5-Hydroxytryptamine | A | pKi | 5.7 | 5.7 | 5.7 | Guide to Pharmacology |
| β1 | ADRB1 | Human | Adrenoceptors | A | pKi | 8.6 | 9.05 | 9.7 | Guide to Pharmacology |
| β2 | ADRB2 | Human | Adrenoceptors | A | pKi | 9.4 | 9.4 | 9.4 | Guide to Pharmacology |
| 5-HT1B | 5HT1B | Rat | 5-Hydroxytryptamine | A | pKi | 7.1 | 7.1 | 7.1 | ChEMBL |
| 5-HT1B | 5HT1B | Human | 5-Hydroxytryptamine | A | pKi | 5.58 | 5.58 | 5.58 | ChEMBL |
| β3 | ADRB3 | Human | Adrenoceptors | A | pKd | 6.78 | 6.78 | 6.78 | ChEMBL |
| β3 | ADRB3 | Human | Adrenoceptors | A | pKi | 7.18 | 7.18 | 7.18 | ChEMBL |
| β1 | ADRB1 | Human | Adrenoceptors | A | pKd | 8.58 | 8.6 | 8.62 | ChEMBL |
| β1 | ADRB1 | Human | Adrenoceptors | A | pKi | 9.27 | 9.27 | 9.28 | ChEMBL |
| 5-HT1A | 5HT1A | Rat | 5-Hydroxytryptamine | A | pKi | 7.57 | 7.64 | 7.7 | ChEMBL |
| D4 | DRD4 | Human | Dopamine | A | pKi | 5.78 | 5.78 | 5.78 | ChEMBL |
| β2 | ADRB2 | Human | Adrenoceptors | A | pKd | 9.18 | 9.22 | 9.27 | ChEMBL |
| β2 | ADRB2 | Human | Adrenoceptors | A | pKi | 8.31 | 9.15 | 9.49 | ChEMBL |
| 5-HT1A | 5HT1A | Human | 5-Hydroxytryptamine | A | pKd | 7.2 | 7.2 | 7.2 | ChEMBL |
| 5-HT1A | 5HT1A | Human | 5-Hydroxytryptamine | A | pKi | 6.81 | 7.23 | 7.65 | ChEMBL |
| D3 | DRD3 | Human | Dopamine | A | pKi | 6.0 | 6.0 | 6.0 | ChEMBL |
| β3 | ADRB3 | Human | Adrenoceptors | A | pKd | 8.17 | 8.17 | 8.17 | Drug Central |
| 5-HT1A | 5HT1A | Human | 5-Hydroxytryptamine | A | pKi | 8.09 | 8.09 | 8.09 | Drug Central |
| 5-HT1B | 5HT1B | Human | 5-Hydroxytryptamine | A | pKi | 8.15 | 8.15 | 8.15 | Drug Central |
| 5-HT1D | 5HT1D | Human | 5-Hydroxytryptamine | A | pKi | 8.28 | 8.28 | 8.28 | Drug Central |
| 5-HT2A | 5HT2A | Human | 5-Hydroxytryptamine | A | pKi | 8.3 | 8.3 | 8.3 | Drug Central |
| 5-HT2B | 5HT2B | Human | 5-Hydroxytryptamine | A | pKi | 8.24 | 8.24 | 8.24 | Drug Central |
| β1 | ADRB1 | Human | Adrenoceptors | A | pKi | 8.03 | 8.03 | 8.03 | Drug Central |
| β2 | ADRB2 | Human | Adrenoceptors | A | pKi | 8.05 | 8.05 | 8.05 | Drug Central |
| 5-HT1A | 5HT1A | Rat | 5-Hydroxytryptamine | A | pKi | 8.11 | 8.11 | 8.11 | Drug Central |
| 5-HT1B | 5HT1B | Rat | 5-Hydroxytryptamine | A | pKi | 8.15 | 8.15 | 8.15 | Drug Central |
| 5-HT2C | 5HT2C | Human | 5-Hydroxytryptamine | A | pKi | 8.37 | 8.37 | 8.37 | Drug Central |
| 5-HT2C | 5HT2C | Human | 5-Hydroxytryptamine | A | pKi | 4.27 | 4.27 | 4.27 | ChEMBL |
| 5-HT5A | 5HT5A | Human | 5-Hydroxytryptamine | A | pKi | 5.15 | 5.15 | 5.15 | ChEMBL |
| Receptor | Activity | Source | |||||||
|---|---|---|---|---|---|---|---|---|---|
| GTP | Uniprot | Species | Family | Class | Type | Min | Avg | Max | Database |
| β3 | ADRB3 | Human | Adrenoceptors | A | pEC50 | 5.6 | 6.5 | 7.4 | Guide to Pharmacology |
| M1 | ACM1 | Rat | Acetylcholine (muscarinic) | A | Potency | 7.5 | 7.5 | 7.5 | ChEMBL |
| β3 | ADRB3 | Human | Adrenoceptors | A | pIC50 | 7.06 | 7.06 | 7.06 | ChEMBL |
| β1 | ADRB1 | Human | Adrenoceptors | A | pIC50 | 9.04 | 9.04 | 9.04 | ChEMBL |
| 5-HT1A | 5HT1A | Rat | 5-Hydroxytryptamine | A | pIC50 | 7.32 | 7.32 | 7.32 | ChEMBL |
| β2 | ADRB2 | Human | Adrenoceptors | A | pIC50 | 8.66 | 8.96 | 9.26 | ChEMBL |
| 5-HT1A | 5HT1A | Human | 5-Hydroxytryptamine | A | pEC50 | 7.57 | 7.57 | 7.57 | ChEMBL |