perphenazine
| SMILES | OCCN1CCN(CC1)CCCN1c2ccccc2Sc2c1cc(Cl)cc2 |
| InChIKey | RGCVKNLCSQQDEP-UHFFFAOYSA-N |
Chemical properties
| Hydrogen bond acceptors | 5 |
| Hydrogen bond donors | 1 |
| Rotatable bonds | 6 |
| Molecular weight (Da) | 403.1 |
Drug properties
| Molecular type | Small molecule |
| Physiological/Surrogate | Surrogate |
| Approved drug | Yes |
Database connections
Bioactivities
| Receptor | Activity | Source | |||||||
|---|---|---|---|---|---|---|---|---|---|
| GTP | Uniprot | Species | Family | Class | Type | Min | Avg | Max | Database |
| 5-HT2C | 5HT2C | Human | 5-Hydroxytryptamine | A | pKi | 6.9 | 6.9 | 6.9 | Guide to Pharmacology |
| 5-HT6 | 5HT6R | Human | 5-Hydroxytryptamine | A | pKi | 7.1 | 7.1 | 7.1 | Guide to Pharmacology |
| 5-HT7 | 5HT7R | Human | 5-Hydroxytryptamine | A | pKi | 7.2 | 7.2 | 7.2 | Guide to Pharmacology |
| D2 | DRD2 | Human | Dopamine | A | pKi | 8.85 | 9.22 | 9.59 | Guide to Pharmacology |
| H1 | HRH1 | Human | Histamine | A | pKi | 8.1 | 8.1 | 8.1 | Guide to Pharmacology |
| 5-HT6 | 5HT6R | Rat | 5-Hydroxytryptamine | A | pKi | 7.8 | 7.8 | 7.8 | Guide to Pharmacology |
| 5-HT7 | 5HT7R | Rat | 5-Hydroxytryptamine | A | pKi | 7.6 | 7.6 | 7.6 | Guide to Pharmacology |
| 5-HT7 | 5HT7R | Human | 5-Hydroxytryptamine | A | pKi | 7.64 | 7.64 | 7.64 | ChEMBL |
| 5-HT6 | 5HT6R | Human | 5-Hydroxytryptamine | A | pKi | 8.12 | 8.12 | 8.12 | Drug Central |
| D4 | DRD4 | Human | Dopamine | A | pKi | 8.12 | 8.12 | 8.12 | Drug Central |
| 5-HT7 | 5HT7R | Rat | 5-Hydroxytryptamine | A | pKi | 8.12 | 8.12 | 8.12 | Drug Central |
| α2A | ADA2A | Human | Adrenoceptors | A | pKi | 8.21 | 8.21 | 8.21 | Drug Central |
| D2 | DRD2 | Human | Dopamine | A | pKi | 8.03 | 8.03 | 8.03 | Drug Central |
| 5-HT1A | 5HT1A | Human | 5-Hydroxytryptamine | A | pKi | 8.22 | 8.22 | 8.22 | Drug Central |
| 5-HT2A | 5HT2A | Human | 5-Hydroxytryptamine | A | pKi | 8.08 | 8.08 | 8.08 | Drug Central |
| 5-HT2A | 5HT2A | Human | 5-Hydroxytryptamine | A | pKi | 8.2 | 8.2 | 8.2 | Guide to Pharmacology |
| 5-HT2C | 5HT2C | Human | 5-Hydroxytryptamine | A | pKi | 8.16 | 8.16 | 8.16 | Drug Central |
| 5-HT7 | 5HT7R | Human | 5-Hydroxytryptamine | A | pKi | 8.12 | 8.12 | 8.12 | Drug Central |
| M3 | ACM3 | Human | Acetylcholine (muscarinic) | A | pKi | 8.24 | 8.24 | 8.24 | Drug Central |
| α1A | ADA1A | Human | Adrenoceptors | A | pKi | 8.1 | 8.1 | 8.1 | Drug Central |
| α2B | ADA2B | Human | Adrenoceptors | A | pKi | 8.16 | 8.16 | 8.16 | Drug Central |
| α2C | ADA2C | Human | Adrenoceptors | A | pKi | 8.15 | 8.15 | 8.15 | Drug Central |
| D3 | DRD3 | Human | Dopamine | A | pKi | 8.02 | 8.02 | 8.02 | Drug Central |
| H1 | HRH1 | Human | Histamine | A | pKi | 8.09 | 8.09 | 8.09 | Drug Central |
| 5-HT6 | 5HT6R | Rat | 5-Hydroxytryptamine | A | pKi | 8.11 | 8.11 | 8.11 | Drug Central |
| Receptor | Activity | Source | |||||||
|---|---|---|---|---|---|---|---|---|---|
| GTP | Uniprot | Species | Family | Class | Type | Min | Avg | Max | Database |
| FPR3 | FPR3 | Human | Formylpeptide | A | pIC50 | 5.21 | 5.21 | 5.21 | ChEMBL |
| GPR183 | GP183 | Human | Orphan | A | pIC50 | 5.38 | 5.38 | 5.38 | ChEMBL |
| CX3CR1 | CX3C1 | Human | Chemokine | A | pIC50 | 5.53 | 5.53 | 5.53 | ChEMBL |
| GPR35 | GPR35 | Human | Orphan | A | pIC50 | 5.22 | 5.22 | 5.22 | ChEMBL |
| M1 | ACM1 | Rat | Acetylcholine (muscarinic) | A | Potency | 4.7 | 4.83 | 4.95 | ChEMBL |
| GPR119 | GP119 | Human | GPR18, GPR55 and GPR119 | A | pIC50 | 5.29 | 5.29 | 5.29 | ChEMBL |
| α2A | ADA2A | Human | Adrenoceptors | A | pIC50 | 5.56 | 5.56 | 5.56 | ChEMBL |
| β2 | ADRB2 | Human | Adrenoceptors | A | pIC50 | 5.56 | 5.56 | 5.56 | ChEMBL |
| apelin | APJ | Human | Apelin | A | pIC50 | 5.49 | 5.49 | 5.49 | ChEMBL |
| D2 | DRD2 | Human | Dopamine | A | pIC50 | 9.52 | 9.52 | 9.52 | ChEMBL |
| NPS | NPSR1 | Human | Neuropeptide S | A | Potency | 4.6 | 4.8 | 5.0 | ChEMBL |
| TSH | TSHR | Human | Glycoprotein hormone | A | Potency | 4.8 | 4.8 | 4.8 | ChEMBL |
| FPR1 | FPR1 | Human | Formylpeptide | A | pIC50 | 5.32 | 5.32 | 5.32 | ChEMBL |
| GLP-1 | GLP1R | Human | Glucagon | B1 | pIC50 | 5.41 | 5.41 | 5.41 | ChEMBL |